C22H33ClN7O2+ — CID 57402002
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[[2-(4-methylphenyl)acetyl]amino]butyl]azanium (PubChem CID 57402002) has the molecular formula C22H33ClN7O2+ and a molecular weight of 463.01 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[[2-(4-methylphenyl)acetyl]amino]butyl]azanium.
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[[2-(4-methylphenyl)acetyl]amino]butyl]azanium |
|---|---|
| PubChem CID | 57402002 |
| Molecular Formula | C22H33ClN7O2+ |
| Molecular Weight | 463.01 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[[2-(4-methylphenyl)acetyl]amino]butyl]azanium |
| SMILES | Cc1ccc(CC(=O)NCCCC[N+](C)(C)CCNC(=O)c2nc(Cl)c(N)nc2N)cc1 |
| InChI | InChI=1S/C22H32ClN7O2/c1-15-6-8-16(9-7-15)14-17(31)26-10-4-5-12-30(2,3)13-11-27-22(32)18-20(24)29-21(25)19(23)28-18/h6-9H,4-5,10-14H2,1-3H3,(H5-,24,25,26,27,29,31,32)/p+1 |
| InChIKey | ZCUVPDONCFDXLI-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.01 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|