C19H22N8O — CID 57402010
1,3-dimethyl-1-[[6-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-2-pyridinyl]methyl]urea (PubChem CID 57402010) has the molecular formula C19H22N8O and a molecular weight of 378.44 g/mol. Its IUPAC name is 1,3-dimethyl-1-[[6-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-2-pyridinyl]methyl]urea.
| Compound Name | 1,3-dimethyl-1-[[6-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-2-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 57402010 |
| Molecular Formula | C19H22N8O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1,3-dimethyl-1-[[6-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-2-pyridinyl]methyl]urea |
| SMILES | CNC(=O)N(C)Cc1cccc(-c2cc3c(nc(NC)c4ncn(C)c43)[nH]2)n1 |
| InChI | InChI=1S/C19H22N8O/c1-20-18-15-16(27(4)10-22-15)12-8-14(24-17(12)25-18)13-7-5-6-11(23-13)9-26(3)19(28)21-2/h5-8,10H,9H2,1-4H3,(H,21,28)(H2,20,24,25) |
| InChIKey | YPCIUWWEHGOPNN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |