C33H36ClF3N4O4 — CID 57402055
(2R)-N-[[5-chloro-2-(3-methoxypropyl)-4-pyridinyl]methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide (PubChem CID 57402055) has the molecular formula C33H36ClF3N4O4 and a molecular weight of 645.12 g/mol. Its IUPAC name is (2R)-N-[[5-chloro-2-(3-methoxypropyl)-4-pyridinyl]methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide.
| Compound Name | (2R)-N-[[5-chloro-2-(3-methoxypropyl)-4-pyridinyl]methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 57402055 |
| Molecular Formula | C33H36ClF3N4O4 |
| Molecular Weight | 645.12 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | (2R)-N-[[5-chloro-2-(3-methoxypropyl)-4-pyridinyl]methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide |
| SMILES | COCCCc1cc(CN(C(=O)[C@H]2CNCC(=O)N2c2ccc(CCCOc3c(F)ccc(F)c3F)cc2)C2CC2)c(Cl)cn1 |
| InChI | InChI=1S/C33H36ClF3N4O4/c1-44-14-3-5-23-16-22(26(34)17-39-23)20-40(24-10-11-24)33(43)29-18-38-19-30(42)41(29)25-8-6-21(7-9-25)4-2-15-45-32-28(36)13-12-27(35)31(32)37/h6-9,12-13,16-17,24,29,38H,2-5,10-11,14-15,18-20H2,1H3/t29-/m1/s1 |
| InChIKey | MVXUANGOKWZRSI-GDLZYMKVSA-N |
| XLogP | 5.24 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.12 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|