C19H31N7O2S — CID 57402325
6-[3-(4-methylpiperazin-1-yl)propylamino]-N-(1,3,5-trimethylpyrazol-4-yl)pyridine-3-sulfonamide (PubChem CID 57402325) has the molecular formula C19H31N7O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 6-[3-(4-methylpiperazin-1-yl)propylamino]-N-(1,3,5-trimethylpyrazol-4-yl)pyridine-3-sulfonamide.
| Compound Name | 6-[3-(4-methylpiperazin-1-yl)propylamino]-N-(1,3,5-trimethylpyrazol-4-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 57402325 |
| Molecular Formula | C19H31N7O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 6-[3-(4-methylpiperazin-1-yl)propylamino]-N-(1,3,5-trimethylpyrazol-4-yl)pyridine-3-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1NS(=O)(=O)c1ccc(NCCCN2CCN(C)CC2)nc1 |
| InChI | InChI=1S/C19H31N7O2S/c1-15-19(16(2)25(4)22-15)23-29(27,28)17-6-7-18(21-14-17)20-8-5-9-26-12-10-24(3)11-13-26/h6-7,14,23H,5,8-13H2,1-4H3,(H,20,21) |
| InChIKey | VCBSTZQLEZNXPL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|