C27H22Cl2N6O4 — CID 57402457
dimethyl 5,8-bis(4-chlorophenyl)-13-methyl-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,9,12,14-pentaene-3,10-dicarboxylate (PubChem CID 57402457) has the molecular formula C27H22Cl2N6O4 and a molecular weight of 565.42 g/mol. Its IUPAC name is dimethyl 5,8-bis(4-chlorophenyl)-13-methyl-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,9,12,14-pentaene-3,10-dicarboxylate.
| Compound Name | dimethyl 5,8-bis(4-chlorophenyl)-13-methyl-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,9,12,14-pentaene-3,10-dicarboxylate |
|---|---|
| PubChem CID | 57402457 |
| Molecular Formula | C27H22Cl2N6O4 |
| Molecular Weight | 565.42 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | dimethyl 5,8-bis(4-chlorophenyl)-13-methyl-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,9,12,14-pentaene-3,10-dicarboxylate |
| SMILES | COC(=O)C1=NN(c2ccc(Cl)cc2)C2C3N(c4ccc(Cl)cc4)N=C(C(=O)OC)N3c3c(C)cccc3N12 |
| InChI | InChI=1S/C27H22Cl2N6O4/c1-15-5-4-6-20-21(15)33-23(27(37)39-3)31-35(19-13-9-17(29)10-14-19)25(33)24-32(20)22(26(36)38-2)30-34(24)18-11-7-16(28)8-12-18/h4-14,24-25H,1-3H3 |
| InChIKey | HXLOBGOKFLYSBC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 90.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |