C24H24FNO5S — CID 57402485
(2R)-2-[[4-[4-[(3-fluorophenyl)methoxy]phenyl]phenyl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 57402485) has the molecular formula C24H24FNO5S and a molecular weight of 457.52 g/mol. Its IUPAC name is (2R)-2-[[4-[4-[(3-fluorophenyl)methoxy]phenyl]phenyl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[4-[4-[(3-fluorophenyl)methoxy]phenyl]phenyl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 57402485 |
| Molecular Formula | C24H24FNO5S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | (2R)-2-[[4-[4-[(3-fluorophenyl)methoxy]phenyl]phenyl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1ccc(-c2ccc(OCc3cccc(F)c3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C24H24FNO5S/c1-16(2)23(24(27)28)26-32(29,30)22-12-8-19(9-13-22)18-6-10-21(11-7-18)31-15-17-4-3-5-20(25)14-17/h3-14,16,23,26H,15H2,1-2H3,(H,27,28)/t23-/m1/s1 |
| InChIKey | KQIHNYZYABCSQP-HSZRJFAPSA-N |
| XLogP | 4.46 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |