C20H26N2O3 — CID 57402502
methyl 9-[4-(dimethylamino)-4-oxobutyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate (PubChem CID 57402502) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is methyl 9-[4-(dimethylamino)-4-oxobutyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate.
| Compound Name | methyl 9-[4-(dimethylamino)-4-oxobutyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 57402502 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | methyl 9-[4-(dimethylamino)-4-oxobutyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2CCCC(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C20H26N2O3/c1-21(2)19(23)9-6-12-22-17-8-5-4-7-15(17)16-13-14(20(24)25-3)10-11-18(16)22/h10-11,13H,4-9,12H2,1-3H3 |
| InChIKey | ICZRKUHVLZKQSR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|