C23H18ClNO3 — CID 57402607
2-[3-(4-chlorophenoxy)-2-methyl-4-phenylindol-1-yl]acetic acid (PubChem CID 57402607) has the molecular formula C23H18ClNO3 and a molecular weight of 391.85 g/mol. Its IUPAC name is 2-[3-(4-chlorophenoxy)-2-methyl-4-phenylindol-1-yl]acetic acid.
| Compound Name | 2-[3-(4-chlorophenoxy)-2-methyl-4-phenylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 57402607 |
| Molecular Formula | C23H18ClNO3 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-[3-(4-chlorophenoxy)-2-methyl-4-phenylindol-1-yl]acetic acid |
| SMILES | Cc1c(Oc2ccc(Cl)cc2)c2c(-c3ccccc3)cccc2n1CC(=O)O |
| InChI | InChI=1S/C23H18ClNO3/c1-15-23(28-18-12-10-17(24)11-13-18)22-19(16-6-3-2-4-7-16)8-5-9-20(22)25(15)14-21(26)27/h2-13H,14H2,1H3,(H,26,27) |
| InChIKey | PBGVYGZYNYDMMO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |