C19H20N2O2 — CID 57402760
1-[(1S)-1,2-bis(4-methoxyphenyl)ethyl]imidazole (PubChem CID 57402760) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-[(1S)-1,2-bis(4-methoxyphenyl)ethyl]imidazole.
| Compound Name | 1-[(1S)-1,2-bis(4-methoxyphenyl)ethyl]imidazole |
|---|---|
| PubChem CID | 57402760 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-[(1S)-1,2-bis(4-methoxyphenyl)ethyl]imidazole |
| SMILES | COc1ccc(C[C@@H](c2ccc(OC)cc2)n2ccnc2)cc1 |
| InChI | InChI=1S/C19H20N2O2/c1-22-17-7-3-15(4-8-17)13-19(21-12-11-20-14-21)16-5-9-18(23-2)10-6-16/h3-12,14,19H,13H2,1-2H3/t19-/m0/s1 |
| InChIKey | MKJGUKZXTVHQHM-IBGZPJMESA-N |
| XLogP | 3.73 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |