About 8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride
8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride (PubChem CID 57402766) has the molecular formula C16H12BrClN2
and a molecular weight of 347.64 g/mol. Its IUPAC name is 8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride.
Molecular Properties
| Compound Name | 8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride |
| PubChem CID | 57402766 |
| Molecular Formula | C16H12BrClN2 |
| Molecular Weight | 347.64 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride |
| SMILES | Cl.Cn1cc2c3cc(Br)ccc3nc-2c2ccccc21 |
| InChI | InChI=1S/C16H11BrN2.ClH/c1-19-9-13-12-8-10(17)6-7-14(12)18-16(13)11-4-2-3-5-15(11)19;/h2-9H,1H3;1H |
| InChIKey | GKQBPQRTTXJQEY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride?
The IUPAC name of 8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride (CID 57402766) is 8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride.
What is the SMILES notation for 8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride?
The canonical SMILES for 8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride is Cl.Cn1cc2c3cc(Br)ccc3nc-2c2ccccc21.
What is the InChIKey of 8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride?
The InChIKey is GKQBPQRTTXJQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BrN2.ClH/c1-19-9-13-12-8-10(17)6-7-14(12)18-16(13)11-4-2-3-5-15(11)19;/h2-9H,1H3;1H.
What are the key properties of 8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride?
8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride has a molecular weight of 347.64 g/mol, XLogP of 5.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-5-methylindolo[3,2-c]quinoline;hydrochloride is sourced from PubChem (CID 57402766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).