C20H30O4 — CID 57402797
6-[(2S,5E)-2,7-dihydroxy-6,10-dimethyl-8-oxoundeca-5,9-dien-2-yl]-3-methylcyclohex-2-en-1-one (PubChem CID 57402797) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 6-[(2S,5E)-2,7-dihydroxy-6,10-dimethyl-8-oxoundeca-5,9-dien-2-yl]-3-methylcyclohex-2-en-1-one.
| Compound Name | 6-[(2S,5E)-2,7-dihydroxy-6,10-dimethyl-8-oxoundeca-5,9-dien-2-yl]-3-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 57402797 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 6-[(2S,5E)-2,7-dihydroxy-6,10-dimethyl-8-oxoundeca-5,9-dien-2-yl]-3-methylcyclohex-2-en-1-one |
| SMILES | CC(C)=CC(=O)C(O)/C(C)=C/CC[C@](C)(O)C1CCC(C)=CC1=O |
| InChI | InChI=1S/C20H30O4/c1-13(2)11-18(22)19(23)15(4)7-6-10-20(5,24)16-9-8-14(3)12-17(16)21/h7,11-12,16,19,23-24H,6,8-10H2,1-5H3/b15-7+/t16?,19?,20-/m0/s1 |
| InChIKey | MMCHYQXMIUOBDF-DZFGGSJHSA-N |
| XLogP | 3.29 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|