C18H20ClN5O4 — CID 57402834
(1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[2-(4-methoxy-3-pyridinyl)ethynyl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 57402834) has the molecular formula C18H20ClN5O4 and a molecular weight of 405.84 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[2-(4-methoxy-3-pyridinyl)ethynyl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[2-(4-methoxy-3-pyridinyl)ethynyl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 57402834 |
| Molecular Formula | C18H20ClN5O4 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[2-(4-methoxy-3-pyridinyl)ethynyl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | COc1ccncc1C#Cc1c(Cl)nc(N)nc1N[C@@H]1C[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H20ClN5O4/c1-28-13-4-5-21-7-9(13)2-3-11-16(19)23-18(20)24-17(11)22-12-6-10(8-25)14(26)15(12)27/h4-5,7,10,12,14-15,25-27H,6,8H2,1H3,(H3,20,22,23,24)/t10-,12-,14-,15+/m1/s1 |
| InChIKey | APXZTXPRJBHWFT-LTZCYQRMSA-N |
| XLogP | 0.03 |
| TPSA | 146.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|