C19H18N4O2 — CID 57402840
1-oxo-N-(pyridin-3-ylmethyl)-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-8-carboxamide (PubChem CID 57402840) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-oxo-N-(pyridin-3-ylmethyl)-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-8-carboxamide.
| Compound Name | 1-oxo-N-(pyridin-3-ylmethyl)-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-8-carboxamide |
|---|---|
| PubChem CID | 57402840 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-oxo-N-(pyridin-3-ylmethyl)-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-8-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1ccc2cc3n(c2c1)CCCNC3=O |
| InChI | InChI=1S/C19H18N4O2/c24-18(22-12-13-3-1-6-20-11-13)15-5-4-14-9-17-19(25)21-7-2-8-23(17)16(14)10-15/h1,3-6,9-11H,2,7-8,12H2,(H,21,25)(H,22,24) |
| InChIKey | LGGWWYULJHBMPH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |