C19H22N2O2 — CID 57402863
(6R,12bS)-6-(hydroxymethyl)-12-prop-2-enyl-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizin-4-one (PubChem CID 57402863) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (6R,12bS)-6-(hydroxymethyl)-12-prop-2-enyl-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizin-4-one.
| Compound Name | (6R,12bS)-6-(hydroxymethyl)-12-prop-2-enyl-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizin-4-one |
|---|---|
| PubChem CID | 57402863 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (6R,12bS)-6-(hydroxymethyl)-12-prop-2-enyl-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizin-4-one |
| SMILES | C=CCn1c2c(c3ccccc31)C[C@H](CO)N1C(=O)CCC[C@@H]21 |
| InChI | InChI=1S/C19H22N2O2/c1-2-10-20-16-7-4-3-6-14(16)15-11-13(12-22)21-17(19(15)20)8-5-9-18(21)23/h2-4,6-7,13,17,22H,1,5,8-12H2/t13-,17+/m1/s1 |
| InChIKey | DIGRRGLKETZHPG-DYVFJYSZSA-N |
| XLogP | 2.80 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|