About 1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride
1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride (PubChem CID 57402902) has the molecular formula C18H37ClN2
and a molecular weight of 316.96 g/mol. Its IUPAC name is 1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | 1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride |
| PubChem CID | 57402902 |
| Molecular Formula | C18H37ClN2 |
| Molecular Weight | 316.96 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride |
| SMILES | CC1(C)CCCN(CCCCN2CCCC(C)(C)C2)C1.Cl |
| InChI | InChI=1S/C18H36N2.ClH/c1-17(2)9-7-13-19(15-17)11-5-6-12-20-14-8-10-18(3,4)16-20;/h5-16H2,1-4H3;1H |
| InChIKey | ZMZRCVSXEDZUMC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.96 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride?
The IUPAC name of 1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride (CID 57402902) is 1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride.
What is the SMILES notation for 1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride?
The canonical SMILES for 1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride is CC1(C)CCCN(CCCCN2CCCC(C)(C)C2)C1.Cl.
What is the InChIKey of 1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride?
The InChIKey is ZMZRCVSXEDZUMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N2.ClH/c1-17(2)9-7-13-19(15-17)11-5-6-12-20-14-8-10-18(3,4)16-20;/h5-16H2,1-4H3;1H.
What are the key properties of 1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride?
1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride has a molecular weight of 316.96 g/mol, XLogP of 4.43, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,3-dimethylpiperidin-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride is sourced from PubChem (CID 57402902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).