C16H24N2O — CID 57402933
1-(1,2,3,4,4a,9a-hexahydrocarbazol-9-yl)-3-(methylamino)propan-2-ol (PubChem CID 57402933) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,9a-hexahydrocarbazol-9-yl)-3-(methylamino)propan-2-ol.
| Compound Name | 1-(1,2,3,4,4a,9a-hexahydrocarbazol-9-yl)-3-(methylamino)propan-2-ol |
|---|---|
| PubChem CID | 57402933 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 1-(1,2,3,4,4a,9a-hexahydrocarbazol-9-yl)-3-(methylamino)propan-2-ol |
| SMILES | CNCC(O)CN1c2ccccc2C2CCCCC21 |
| InChI | InChI=1S/C16H24N2O/c1-17-10-12(19)11-18-15-8-4-2-6-13(15)14-7-3-5-9-16(14)18/h2,4,6,8,12,14,16-17,19H,3,5,7,9-11H2,1H3 |
| InChIKey | CLEGTFPJUAEKOX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |