C21H24ClN5O4 — CID 57402962
2-[2-[2-amino-4-chloro-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]pyrimidin-5-yl]ethynyl]-N-ethylbenzamide (PubChem CID 57402962) has the molecular formula C21H24ClN5O4 and a molecular weight of 445.91 g/mol. Its IUPAC name is 2-[2-[2-amino-4-chloro-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]pyrimidin-5-yl]ethynyl]-N-ethylbenzamide.
| Compound Name | 2-[2-[2-amino-4-chloro-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]pyrimidin-5-yl]ethynyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 57402962 |
| Molecular Formula | C21H24ClN5O4 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-[2-[2-amino-4-chloro-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]pyrimidin-5-yl]ethynyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccccc1C#Cc1c(Cl)nc(N)nc1N[C@@H]1C[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H24ClN5O4/c1-2-24-20(31)13-6-4-3-5-11(13)7-8-14-18(22)26-21(23)27-19(14)25-15-9-12(10-28)16(29)17(15)30/h3-6,12,15-17,28-30H,2,9-10H2,1H3,(H,24,31)(H3,23,25,26,27)/t12-,15-,16-,17+/m1/s1 |
| InChIKey | FMCQNMBCMQNOGQ-YYQUZTFQSA-N |
| XLogP | 0.38 |
| TPSA | 153.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|