About 2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide
2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide (PubChem CID 57403027) has the molecular formula C21H15F3N6O2
and a molecular weight of 440.39 g/mol. Its IUPAC name is 2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide.
Molecular Properties
| Compound Name | 2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide |
| PubChem CID | 57403027 |
| Molecular Formula | C21H15F3N6O2 |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1Nc1cc(Oc2ccc(-n3cncn3)cc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C21H15F3N6O2/c22-21(23,24)16-10-27-19(9-18(16)29-17-4-2-1-3-15(17)20(25)31)32-14-7-5-13(6-8-14)30-12-26-11-28-30/h1-12H,(H2,25,31)(H,27,29) |
| InChIKey | PQVPHORDWRBWLS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide?
The IUPAC name of 2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide (CID 57403027) is 2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide.
What is the SMILES notation for 2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide?
The canonical SMILES for 2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide is NC(=O)c1ccccc1Nc1cc(Oc2ccc(-n3cncn3)cc2)ncc1C(F)(F)F.
What is the InChIKey of 2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide?
The InChIKey is PQVPHORDWRBWLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F3N6O2/c22-21(23,24)16-10-27-19(9-18(16)29-17-4-2-1-3-15(17)20(25)31)32-14-7-5-13(6-8-14)30-12-26-11-28-30/h1-12H,(H2,25,31)(H,27,29).
What are the key properties of 2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide?
2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide has a molecular weight of 440.39 g/mol, XLogP of 4.32, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[4-(1,2,4-triazol-1-yl)phenoxy]-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide is sourced from PubChem (CID 57403027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).