About N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide
N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide (PubChem CID 57403049) has the molecular formula C25H23NO5S
and a molecular weight of 449.53 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide.
Molecular Properties
| Compound Name | N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide |
| PubChem CID | 57403049 |
| Molecular Formula | C25H23NO5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide |
| SMILES | COc1ccc2cc(S(=O)(=O)Nc3ccc(-c4ccc(OC)c(OC)c4)cc3)ccc2c1 |
| InChI | InChI=1S/C25H23NO5S/c1-29-22-11-6-19-15-23(12-7-18(19)14-22)32(27,28)26-21-9-4-17(5-10-21)20-8-13-24(30-2)25(16-20)31-3/h4-16,26H,1-3H3 |
| InChIKey | ILYMLIIWPUWOSS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide?
The IUPAC name of N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide (CID 57403049) is N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide.
What is the SMILES notation for N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide?
The canonical SMILES for N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide is COc1ccc2cc(S(=O)(=O)Nc3ccc(-c4ccc(OC)c(OC)c4)cc3)ccc2c1.
What is the InChIKey of N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide?
The InChIKey is ILYMLIIWPUWOSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO5S/c1-29-22-11-6-19-15-23(12-7-18(19)14-22)32(27,28)26-21-9-4-17(5-10-21)20-8-13-24(30-2)25(16-20)31-3/h4-16,26H,1-3H3.
What are the key properties of N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide?
N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide has a molecular weight of 449.53 g/mol, XLogP of 5.33, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3,4-dimethoxyphenyl)phenyl]-6-methoxynaphthalene-2-sulfonamide is sourced from PubChem (CID 57403049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).