C20H20N6O2 — CID 57403069
4-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]methylamino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 57403069) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 4-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]methylamino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]methylamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 57403069 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]methylamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(NCc2nnc(-c3ccc(N)cc3)o2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C20H20N6O2/c1-13-18(20(27)26(25(13)2)16-6-4-3-5-7-16)22-12-17-23-24-19(28-17)14-8-10-15(21)11-9-14/h3-11,22H,12,21H2,1-2H3 |
| InChIKey | CWYHKPUXGBRDIH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|