About [1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol
[1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol (PubChem CID 57403125) has the molecular formula C20H20N2O3
and a molecular weight of 336.39 g/mol. Its IUPAC name is [1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol.
Molecular Properties
| Compound Name | [1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol |
| PubChem CID | 57403125 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol |
| SMILES | Cc1c(CO)c(-c2ccc([N+](=O)[O-])cc2)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H20N2O3/c1-14-19(13-23)20(17-8-10-18(11-9-17)22(24)25)15(2)21(14)12-16-6-4-3-5-7-16/h3-11,23H,12-13H2,1-2H3 |
| InChIKey | GGFDZIYIMIQGQP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol?
The IUPAC name of [1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol (CID 57403125) is [1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol.
What is the SMILES notation for [1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol?
The canonical SMILES for [1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol is Cc1c(CO)c(-c2ccc([N+](=O)[O-])cc2)c(C)n1Cc1ccccc1.
What is the InChIKey of [1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol?
The InChIKey is GGFDZIYIMIQGQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O3/c1-14-19(13-23)20(17-8-10-18(11-9-17)22(24)25)15(2)21(14)12-16-6-4-3-5-7-16/h3-11,23H,12-13H2,1-2H3.
What are the key properties of [1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol?
[1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol has a molecular weight of 336.39 g/mol, XLogP of 4.22, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-3-yl]methanol is sourced from PubChem (CID 57403125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).