C25H32F2N6O2 — CID 57403185
2-[4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexyl]propan-2-ol (PubChem CID 57403185) has the molecular formula C25H32F2N6O2 and a molecular weight of 486.57 g/mol. Its IUPAC name is 2-[4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexyl]propan-2-ol.
| Compound Name | 2-[4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 57403185 |
| Molecular Formula | C25H32F2N6O2 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2-[4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexyl]propan-2-ol |
| SMILES | CC(C)(O)C1CCC(Nc2ncc3nc(Nc4ccc(F)cc4F)n(C4CCOCC4)c3n2)CC1 |
| InChI | InChI=1S/C25H32F2N6O2/c1-25(2,34)15-3-6-17(7-4-15)29-23-28-14-21-22(32-23)33(18-9-11-35-12-10-18)24(31-21)30-20-8-5-16(26)13-19(20)27/h5,8,13-15,17-18,34H,3-4,6-7,9-12H2,1-2H3,(H,30,31)(H,28,29,32) |
| InChIKey | TULXVNWJSSBZFX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |