C17H22N6O2S2 — CID 57403258
1-methyl-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]imidazole-4-sulfonamide (PubChem CID 57403258) has the molecular formula C17H22N6O2S2 and a molecular weight of 406.54 g/mol. Its IUPAC name is 1-methyl-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]imidazole-4-sulfonamide.
| Compound Name | 1-methyl-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 57403258 |
| Molecular Formula | C17H22N6O2S2 |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1-methyl-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]imidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NCCCCCNc2nc(-c3ccccn3)cs2)c1 |
| InChI | InChI=1S/C17H22N6O2S2/c1-23-11-16(20-13-23)27(24,25)21-10-5-2-4-9-19-17-22-15(12-26-17)14-7-3-6-8-18-14/h3,6-8,11-13,21H,2,4-5,9-10H2,1H3,(H,19,22) |
| InChIKey | QDCVVHLXWOVDEA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|