About 6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine
6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine (PubChem CID 57403334) has the molecular formula C8H11N5O
and a molecular weight of 193.21 g/mol. Its IUPAC name is 6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine |
| PubChem CID | 57403334 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine |
| SMILES | C=CCNc1ncnc(NC)c1N=O |
| InChI | InChI=1S/C8H11N5O/c1-3-4-10-8-6(13-14)7(9-2)11-5-12-8/h3,5H,1,4H2,2H3,(H2,9,10,11,12) |
| InChIKey | UHLXTTUOSZKSPP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine?
The IUPAC name of 6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine (CID 57403334) is 6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine.
What is the SMILES notation for 6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine?
The canonical SMILES for 6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine is C=CCNc1ncnc(NC)c1N=O.
What is the InChIKey of 6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine?
The InChIKey is UHLXTTUOSZKSPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O/c1-3-4-10-8-6(13-14)7(9-2)11-5-12-8/h3,5H,1,4H2,2H3,(H2,9,10,11,12).
What are the key properties of 6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine?
6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine has a molecular weight of 193.21 g/mol, XLogP of 1.51, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-methyl-5-nitroso-4-N-prop-2-enylpyrimidine-4,6-diamine is sourced from PubChem (CID 57403334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).