About 2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide
2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide (PubChem CID 57403441) has the molecular formula C19H17N5O2S2
and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide.
Molecular Properties
| Compound Name | 2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide |
| PubChem CID | 57403441 |
| Molecular Formula | C19H17N5O2S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide |
| SMILES | O=C(Cn1sc2ccccc2c1=O)NCc1cn(CSc2ccccc2)nn1 |
| InChI | InChI=1S/C19H17N5O2S2/c25-18(12-24-19(26)16-8-4-5-9-17(16)28-24)20-10-14-11-23(22-21-14)13-27-15-6-2-1-3-7-15/h1-9,11H,10,12-13H2,(H,20,25) |
| InChIKey | FWVOITRDVTYIMC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide?
The IUPAC name of 2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide (CID 57403441) is 2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide.
What is the SMILES notation for 2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide?
The canonical SMILES for 2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide is O=C(Cn1sc2ccccc2c1=O)NCc1cn(CSc2ccccc2)nn1.
What is the InChIKey of 2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide?
The InChIKey is FWVOITRDVTYIMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O2S2/c25-18(12-24-19(26)16-8-4-5-9-17(16)28-24)20-10-14-11-23(22-21-14)13-27-15-6-2-1-3-7-15/h1-9,11H,10,12-13H2,(H,20,25).
What are the key properties of 2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide?
2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide has a molecular weight of 411.51 g/mol, XLogP of 2.72, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-oxo-1,2-benzothiazol-2-yl)-N-[[1-(phenylsulfanylmethyl)triazol-4-yl]methyl]acetamide is sourced from PubChem (CID 57403441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).