C20H24O3 — CID 57403514
(3aS,9aS)-2-methyl-2-[(E)-3-phenylprop-2-enoxy]-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran (PubChem CID 57403514) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (3aS,9aS)-2-methyl-2-[(E)-3-phenylprop-2-enoxy]-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran.
| Compound Name | (3aS,9aS)-2-methyl-2-[(E)-3-phenylprop-2-enoxy]-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
|---|---|
| PubChem CID | 57403514 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (3aS,9aS)-2-methyl-2-[(E)-3-phenylprop-2-enoxy]-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
| SMILES | CC1(OC/C=C/c2ccccc2)C[C@@H]2OCC3=CCCC[C@]32O1 |
| InChI | InChI=1S/C20H24O3/c1-19(22-13-7-10-16-8-3-2-4-9-16)14-18-20(23-19)12-6-5-11-17(20)15-21-18/h2-4,7-11,18H,5-6,12-15H2,1H3/b10-7+/t18-,19?,20-/m0/s1 |
| InChIKey | KTJRSHSFTMVWCE-ITUMBGMBSA-N |
| XLogP | 4.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|