C32H37N3O8S — CID 57403587
[2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] 4-(2-acetamidoethylamino)-4-oxobutanoate (PubChem CID 57403587) has the molecular formula C32H37N3O8S and a molecular weight of 623.73 g/mol. Its IUPAC name is [2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] 4-(2-acetamidoethylamino)-4-oxobutanoate.
| Compound Name | [2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] 4-(2-acetamidoethylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 57403587 |
| Molecular Formula | C32H37N3O8S |
| Molecular Weight | 623.73 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | [2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] 4-(2-acetamidoethylamino)-4-oxobutanoate |
| SMILES | CC(=O)NCCNC(=O)CCC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(COc1ccc(/C=C3\SC(=O)NC3=O)cc1)O2 |
| InChI | InChI=1S/C32H37N3O8S/c1-18-19(2)29-24(20(3)28(18)42-27(38)11-10-26(37)34-15-14-33-21(4)36)12-13-32(5,43-29)17-41-23-8-6-22(7-9-23)16-25-30(39)35-31(40)44-25/h6-9,16H,10-15,17H2,1-5H3,(H,33,36)(H,34,37)(H,35,39,40)/b25-16- |
| InChIKey | SWOMZUIZQLHYAQ-XYGWBWBKSA-N |
| XLogP | 4.04 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.73 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|