C23H19N3O2S — CID 57403607
3-(1-benzyl-2-methylindol-3-yl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 57403607) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-(1-benzyl-2-methylindol-3-yl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 3-(1-benzyl-2-methylindol-3-yl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 57403607 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 3-(1-benzyl-2-methylindol-3-yl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | Cc1c(C2=NS(=O)(=O)c3ccccc3N2)c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C23H19N3O2S/c1-16-22(23-24-19-12-6-8-14-21(19)29(27,28)25-23)18-11-5-7-13-20(18)26(16)15-17-9-3-2-4-10-17/h2-14H,15H2,1H3,(H,24,25) |
| InChIKey | OLFBGQGPJJFDIV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |