C24H45NO2 — CID 57403642
(11Z,13E,15S)-N,N-diethyl-15-hydroxyicosa-11,13-dienamide (PubChem CID 57403642) has the molecular formula C24H45NO2 and a molecular weight of 379.63 g/mol. Its IUPAC name is (11Z,13E,15S)-N,N-diethyl-15-hydroxyicosa-11,13-dienamide.
| Compound Name | (11Z,13E,15S)-N,N-diethyl-15-hydroxyicosa-11,13-dienamide |
|---|---|
| PubChem CID | 57403642 |
| Molecular Formula | C24H45NO2 |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 379.35 |
| IUPAC Name | (11Z,13E,15S)-N,N-diethyl-15-hydroxyicosa-11,13-dienamide |
| SMILES | CCCCC[C@H](O)/C=C/C=C\CCCCCCCCCC(=O)N(CC)CC |
| InChI | InChI=1S/C24H45NO2/c1-4-7-17-20-23(26)21-18-15-13-11-9-8-10-12-14-16-19-22-24(27)25(5-2)6-3/h13,15,18,21,23,26H,4-12,14,16-17,19-20,22H2,1-3H3/b15-13-,21-18+/t23-/m0/s1 |
| InChIKey | OOLNOJDEVPKINF-WPDQABHYSA-N |
| XLogP | 6.42 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|