About 1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate
1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate (PubChem CID 57403652) has the molecular formula C23H38O6
and a molecular weight of 410.55 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate.
Molecular Properties
| Compound Name | 1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate |
| PubChem CID | 57403652 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate |
| SMILES | CCCCCCc1ccc(O)cc1OCCCCCCCC(=O)OC(CO)CO |
| InChI | InChI=1S/C23H38O6/c1-2-3-4-8-11-19-13-14-20(26)16-22(19)28-15-10-7-5-6-9-12-23(27)29-21(17-24)18-25/h13-14,16,21,24-26H,2-12,15,17-18H2,1H3 |
| InChIKey | YAEAQUQAXZTTPU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate?
The IUPAC name of 1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate (CID 57403652) is 1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate.
What is the SMILES notation for 1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate?
The canonical SMILES for 1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate is CCCCCCc1ccc(O)cc1OCCCCCCCC(=O)OC(CO)CO.
What is the InChIKey of 1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate?
The InChIKey is YAEAQUQAXZTTPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H38O6/c1-2-3-4-8-11-19-13-14-20(26)16-22(19)28-15-10-7-5-6-9-12-23(27)29-21(17-24)18-25/h13-14,16,21,24-26H,2-12,15,17-18H2,1H3.
What are the key properties of 1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate?
1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate has a molecular weight of 410.55 g/mol, XLogP of 4.13, 17 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydroxypropan-2-yl 8-(2-hexyl-5-hydroxyphenoxy)octanoate is sourced from PubChem (CID 57403652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).