C23H35ClN7O2+ — CID 57403751
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[3-(4-methylphenyl)propanoylamino]butyl]azanium (PubChem CID 57403751) has the molecular formula C23H35ClN7O2+ and a molecular weight of 477.03 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[3-(4-methylphenyl)propanoylamino]butyl]azanium.
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[3-(4-methylphenyl)propanoylamino]butyl]azanium |
|---|---|
| PubChem CID | 57403751 |
| Molecular Formula | C23H35ClN7O2+ |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[3-(4-methylphenyl)propanoylamino]butyl]azanium |
| SMILES | Cc1ccc(CCC(=O)NCCCC[N+](C)(C)CCNC(=O)c2nc(Cl)c(N)nc2N)cc1 |
| InChI | InChI=1S/C23H34ClN7O2/c1-16-6-8-17(9-7-16)10-11-18(32)27-12-4-5-14-31(2,3)15-13-28-23(33)19-21(25)30-22(26)20(24)29-19/h6-9H,4-5,10-15H2,1-3H3,(H5-,25,26,27,28,30,32,33)/p+1 |
| InChIKey | AKNSNQKFMYZWMA-UHFFFAOYSA-O |
| XLogP | 1.94 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|