C23H29F3N2O — CID 57403783
11-methyl-2-(oxan-2-ylmethyl)-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole (PubChem CID 57403783) has the molecular formula C23H29F3N2O and a molecular weight of 406.49 g/mol. Its IUPAC name is 11-methyl-2-(oxan-2-ylmethyl)-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole.
| Compound Name | 11-methyl-2-(oxan-2-ylmethyl)-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
|---|---|
| PubChem CID | 57403783 |
| Molecular Formula | C23H29F3N2O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 11-methyl-2-(oxan-2-ylmethyl)-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
| SMILES | CC1c2c([nH]c3ccc(C(F)(F)F)cc23)CC2CCN(CC3CCCCO3)CC21 |
| InChI | InChI=1S/C23H29F3N2O/c1-14-19-13-28(12-17-4-2-3-9-29-17)8-7-15(19)10-21-22(14)18-11-16(23(24,25)26)5-6-20(18)27-21/h5-6,11,14-15,17,19,27H,2-4,7-10,12-13H2,1H3 |
| InChIKey | RWRVBLQXKOJFGU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|