C26H35F3N2O — CID 57403785
(4aR,11R,11aS)-11-methyl-2-[4-(oxan-4-yl)butyl]-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole (PubChem CID 57403785) has the molecular formula C26H35F3N2O and a molecular weight of 448.57 g/mol. Its IUPAC name is (4aR,11R,11aS)-11-methyl-2-[4-(oxan-4-yl)butyl]-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole.
| Compound Name | (4aR,11R,11aS)-11-methyl-2-[4-(oxan-4-yl)butyl]-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
|---|---|
| PubChem CID | 57403785 |
| Molecular Formula | C26H35F3N2O |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | (4aR,11R,11aS)-11-methyl-2-[4-(oxan-4-yl)butyl]-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
| SMILES | C[C@H]1c2c([nH]c3ccc(C(F)(F)F)cc23)C[C@H]2CCN(CCCCC3CCOCC3)C[C@@H]21 |
| InChI | InChI=1S/C26H35F3N2O/c1-17-22-16-31(10-3-2-4-18-8-12-32-13-9-18)11-7-19(22)14-24-25(17)21-15-20(26(27,28)29)5-6-23(21)30-24/h5-6,15,17-19,22,30H,2-4,7-14,16H2,1H3/t17-,19-,22-/m1/s1 |
| InChIKey | ZMARPWJFINEXBX-SFGWALBWSA-N |
| XLogP | 6.38 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|