C30H38N3O3+ — CID 57403853
[(3R)-1-[(6-methyl-1,3-benzoxazol-2-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate (PubChem CID 57403853) has the molecular formula C30H38N3O3+ and a molecular weight of 488.65 g/mol. Its IUPAC name is [(3R)-1-[(6-methyl-1,3-benzoxazol-2-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate.
| Compound Name | [(3R)-1-[(6-methyl-1,3-benzoxazol-2-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 57403853 |
| Molecular Formula | C30H38N3O3+ |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | [(3R)-1-[(6-methyl-1,3-benzoxazol-2-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
| SMILES | Cc1ccc2nc(C[N+]34CCC(CC3)[C@@H](OC(=O)[C@](C)(c3ccccc3)N3CCCCC3)C4)oc2c1 |
| InChI | InChI=1S/C30H38N3O3/c1-22-11-12-25-26(19-22)35-28(31-25)21-33-17-13-23(14-18-33)27(20-33)36-29(34)30(2,24-9-5-3-6-10-24)32-15-7-4-8-16-32/h3,5-6,9-12,19,23,27H,4,7-8,13-18,20-21H2,1-2H3/q+1/t23?,27-,30-,33?/m0/s1 |
| InChIKey | BTNKJHBSKAVDTH-WMBYLGNXSA-N |
| XLogP | 5.19 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|