About 1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane
1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane (PubChem CID 57403891) has the molecular formula C20H29N3
and a molecular weight of 311.47 g/mol. Its IUPAC name is 1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane.
Molecular Properties
| Compound Name | 1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane |
| PubChem CID | 57403891 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | 1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane |
| SMILES | c1ccc2c(CN3CCCNCCCNCCC3)cccc2c1 |
| InChI | InChI=1S/C20H29N3/c1-2-10-20-18(7-1)8-3-9-19(20)17-23-15-5-13-21-11-4-12-22-14-6-16-23/h1-3,7-10,21-22H,4-6,11-17H2 |
| InChIKey | PZAUBWKRRRGCEB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane?
The IUPAC name of 1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane (CID 57403891) is 1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane.
What is the SMILES notation for 1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane?
The canonical SMILES for 1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane is c1ccc2c(CN3CCCNCCCNCCC3)cccc2c1.
What is the InChIKey of 1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane?
The InChIKey is PZAUBWKRRRGCEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N3/c1-2-10-20-18(7-1)8-3-9-19(20)17-23-15-5-13-21-11-4-12-22-14-6-16-23/h1-3,7-10,21-22H,4-6,11-17H2.
What are the key properties of 1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane?
1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane has a molecular weight of 311.47 g/mol, XLogP of 3.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(naphthalen-1-ylmethyl)-1,5,9-triazacyclododecane is sourced from PubChem (CID 57403891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).