C18H39NO2 — CID 57403963
(2S,3R,5S)-2-aminooctadecane-3,5-diol (PubChem CID 57403963) has the molecular formula C18H39NO2 and a molecular weight of 301.52 g/mol. Its IUPAC name is (2S,3R,5S)-2-aminooctadecane-3,5-diol.
| Compound Name | (2S,3R,5S)-2-aminooctadecane-3,5-diol |
|---|---|
| PubChem CID | 57403963 |
| Molecular Formula | C18H39NO2 |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.30 |
| IUPAC Name | (2S,3R,5S)-2-aminooctadecane-3,5-diol |
| SMILES | CCCCCCCCCCCCC[C@H](O)C[C@@H](O)[C@H](C)N |
| InChI | InChI=1S/C18H39NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-17(20)15-18(21)16(2)19/h16-18,20-21H,3-15,19H2,1-2H3/t16-,17-,18+/m0/s1 |
| InChIKey | CILLLUONWCSDCK-OKZBNKHCSA-N |
| XLogP | 4.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|