C36H44FeN4 — CID 57404099
iron;2,3,7,8,12,13,17,18-octaethylporphyrin (PubChem CID 57404099) has the molecular formula C36H44FeN4 and a molecular weight of 588.62 g/mol. Its IUPAC name is iron;2,3,7,8,12,13,17,18-octaethylporphyrin.
| Compound Name | iron;2,3,7,8,12,13,17,18-octaethylporphyrin |
|---|---|
| PubChem CID | 57404099 |
| Molecular Formula | C36H44FeN4 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | iron;2,3,7,8,12,13,17,18-octaethylporphyrin |
| SMILES | CCC1=C(CC)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C(CC)=C5CC)C(CC)=C4CC)C(CC)=C3CC.[Fe] |
| InChI | InChI=1S/C36H44N4.Fe/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20H,9-16H2,1-8H3;/b29-17-,30-18-,31-17-,32-18-,33-19-,34-20-,35-19-,36-20-; |
| InChIKey | JJJLQBFRIUEISN-XTPDIVBZSA-N |
| XLogP | 9.82 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|