C19H23N3O4 — CID 57404200
methyl 2-[(4-carbamoylphenyl)methyl]-3-oxo-3a,5,6,7,8,8a-hexahydro-1H-pyrrolo[3,4-b]pyrrolizine-7a-carboxylate (PubChem CID 57404200) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is methyl 2-[(4-carbamoylphenyl)methyl]-3-oxo-3a,5,6,7,8,8a-hexahydro-1H-pyrrolo[3,4-b]pyrrolizine-7a-carboxylate.
| Compound Name | methyl 2-[(4-carbamoylphenyl)methyl]-3-oxo-3a,5,6,7,8,8a-hexahydro-1H-pyrrolo[3,4-b]pyrrolizine-7a-carboxylate |
|---|---|
| PubChem CID | 57404200 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | methyl 2-[(4-carbamoylphenyl)methyl]-3-oxo-3a,5,6,7,8,8a-hexahydro-1H-pyrrolo[3,4-b]pyrrolizine-7a-carboxylate |
| SMILES | COC(=O)C12CCCN1C1C(=O)N(Cc3ccc(C(N)=O)cc3)CC1C2 |
| InChI | InChI=1S/C19H23N3O4/c1-26-18(25)19-7-2-8-22(19)15-14(9-19)11-21(17(15)24)10-12-3-5-13(6-4-12)16(20)23/h3-6,14-15H,2,7-11H2,1H3,(H2,20,23) |
| InChIKey | NHJSCEAEASUJPS-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |