C28H25F3N4O2 — CID 57404374
1-[6-[(3R,4R)-3-amino-4-(2,4,5-trifluorophenyl)piperidin-1-yl]-3-pyridinyl]-4-phenylmethoxypyridin-2-one (PubChem CID 57404374) has the molecular formula C28H25F3N4O2 and a molecular weight of 506.53 g/mol. Its IUPAC name is 1-[6-[(3R,4R)-3-amino-4-(2,4,5-trifluorophenyl)piperidin-1-yl]-3-pyridinyl]-4-phenylmethoxypyridin-2-one.
| Compound Name | 1-[6-[(3R,4R)-3-amino-4-(2,4,5-trifluorophenyl)piperidin-1-yl]-3-pyridinyl]-4-phenylmethoxypyridin-2-one |
|---|---|
| PubChem CID | 57404374 |
| Molecular Formula | C28H25F3N4O2 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 1-[6-[(3R,4R)-3-amino-4-(2,4,5-trifluorophenyl)piperidin-1-yl]-3-pyridinyl]-4-phenylmethoxypyridin-2-one |
| SMILES | N[C@H]1CN(c2ccc(-n3ccc(OCc4ccccc4)cc3=O)cn2)CC[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C28H25F3N4O2/c29-23-14-25(31)24(30)13-22(23)21-9-10-34(16-26(21)32)27-7-6-19(15-33-27)35-11-8-20(12-28(35)36)37-17-18-4-2-1-3-5-18/h1-8,11-15,21,26H,9-10,16-17,32H2/t21-,26+/m1/s1 |
| InChIKey | OFKFNGSBLPQTPU-RLWLMLJZSA-N |
| XLogP | 4.55 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|