C20H28O3 — CID 57404389
(4aS,4bS,7R)-7-ethenyl-4b,10-dihydroxy-1,1,4a,7-tetramethyl-3,4,5,6-tetrahydro-2H-phenanthren-9-one (PubChem CID 57404389) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (4aS,4bS,7R)-7-ethenyl-4b,10-dihydroxy-1,1,4a,7-tetramethyl-3,4,5,6-tetrahydro-2H-phenanthren-9-one.
| Compound Name | (4aS,4bS,7R)-7-ethenyl-4b,10-dihydroxy-1,1,4a,7-tetramethyl-3,4,5,6-tetrahydro-2H-phenanthren-9-one |
|---|---|
| PubChem CID | 57404389 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (4aS,4bS,7R)-7-ethenyl-4b,10-dihydroxy-1,1,4a,7-tetramethyl-3,4,5,6-tetrahydro-2H-phenanthren-9-one |
| SMILES | C=C[C@]1(C)C=C2C(=O)C(O)=C3C(C)(C)CCC[C@]3(C)[C@@]2(O)CC1 |
| InChI | InChI=1S/C20H28O3/c1-6-18(4)10-11-20(23)13(12-18)14(21)15(22)16-17(2,3)8-7-9-19(16,20)5/h6,12,22-23H,1,7-11H2,2-5H3/t18-,19-,20+/m0/s1 |
| InChIKey | UUOWQGQDPSMWOB-SLFFLAALSA-N |
| XLogP | 4.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|