C7H11NO4S — CID 57404475
(6R,7S,8S,8aS)-6,7,8-trihydroxy-6,7,8,8a-tetrahydro-5H-[1,3]thiazolo[3,2-a]pyridin-3-one (PubChem CID 57404475) has the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. Its IUPAC name is (6R,7S,8S,8aS)-6,7,8-trihydroxy-6,7,8,8a-tetrahydro-5H-[1,3]thiazolo[3,2-a]pyridin-3-one.
| Compound Name | (6R,7S,8S,8aS)-6,7,8-trihydroxy-6,7,8,8a-tetrahydro-5H-[1,3]thiazolo[3,2-a]pyridin-3-one |
|---|---|
| PubChem CID | 57404475 |
| Molecular Formula | C7H11NO4S |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | (6R,7S,8S,8aS)-6,7,8-trihydroxy-6,7,8,8a-tetrahydro-5H-[1,3]thiazolo[3,2-a]pyridin-3-one |
| SMILES | O=C1CS[C@H]2[C@@H](O)[C@@H](O)[C@H](O)CN12 |
| InChI | InChI=1S/C7H11NO4S/c9-3-1-8-4(10)2-13-7(8)6(12)5(3)11/h3,5-7,9,11-12H,1-2H2/t3-,5+,6+,7+/m1/s1 |
| InChIKey | RHYZHAPAYLRGOC-DAXDWZTDSA-N |
| XLogP | -2.02 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |