C12H13NO4S — CID 57404478
(5aS,6S,7S,8R)-6,7,8-trihydroxy-6,7,8,9-tetrahydro-5aH-pyrido[2,1-b][1,3]benzothiazin-11-one (PubChem CID 57404478) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is (5aS,6S,7S,8R)-6,7,8-trihydroxy-6,7,8,9-tetrahydro-5aH-pyrido[2,1-b][1,3]benzothiazin-11-one.
| Compound Name | (5aS,6S,7S,8R)-6,7,8-trihydroxy-6,7,8,9-tetrahydro-5aH-pyrido[2,1-b][1,3]benzothiazin-11-one |
|---|---|
| PubChem CID | 57404478 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | (5aS,6S,7S,8R)-6,7,8-trihydroxy-6,7,8,9-tetrahydro-5aH-pyrido[2,1-b][1,3]benzothiazin-11-one |
| SMILES | O=C1c2ccccc2S[C@H]2[C@@H](O)[C@@H](O)[C@H](O)CN12 |
| InChI | InChI=1S/C12H13NO4S/c14-7-5-13-11(17)6-3-1-2-4-8(6)18-12(13)10(16)9(7)15/h1-4,7,9-10,12,14-16H,5H2/t7-,9+,10+,12+/m1/s1 |
| InChIKey | QSTIQBJVDMSSEK-NKIYYHGXSA-N |
| XLogP | -0.34 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |