C25H25ClO5 — CID 57404695
2-(4-chlorophenyl)-3,5,7-trihydroxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one (PubChem CID 57404695) has the molecular formula C25H25ClO5 and a molecular weight of 440.92 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3,5,7-trihydroxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one.
| Compound Name | 2-(4-chlorophenyl)-3,5,7-trihydroxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one |
|---|---|
| PubChem CID | 57404695 |
| Molecular Formula | C25H25ClO5 |
| Molecular Weight | 440.92 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-(4-chlorophenyl)-3,5,7-trihydroxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2oc(-c3ccc(Cl)cc3)c(O)c(=O)c2c1O |
| InChI | InChI=1S/C25H25ClO5/c1-13(2)5-11-17-20(27)18(12-6-14(3)4)25-19(21(17)28)22(29)23(30)24(31-25)15-7-9-16(26)10-8-15/h5-10,27-28,30H,11-12H2,1-4H3 |
| InChIKey | BUHWIQDHAHREFM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.92 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|