About 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one
5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one (PubChem CID 57405049) has the molecular formula C25H27NO5
and a molecular weight of 421.49 g/mol. Its IUPAC name is 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one.
Molecular Properties
| Compound Name | 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one |
| PubChem CID | 57405049 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one |
| SMILES | COc1c(-c2cccnc2)oc2c(CC=C(C)C)c(O)c(CC=C(C)C)c(O)c2c1=O |
| InChI | InChI=1S/C25H27NO5/c1-14(2)8-10-17-20(27)18(11-9-15(3)4)24-19(21(17)28)22(29)25(30-5)23(31-24)16-7-6-12-26-13-16/h6-9,12-13,27-28H,10-11H2,1-5H3 |
| InChIKey | HZBJKEHHAYYPDI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one?
The IUPAC name of 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one (CID 57405049) is 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one.
What is the SMILES notation for 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one?
The canonical SMILES for 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one is COc1c(-c2cccnc2)oc2c(CC=C(C)C)c(O)c(CC=C(C)C)c(O)c2c1=O.
What is the InChIKey of 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one?
The InChIKey is HZBJKEHHAYYPDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27NO5/c1-14(2)8-10-17-20(27)18(11-9-15(3)4)24-19(21(17)28)22(29)25(30-5)23(31-24)16-7-6-12-26-13-16/h6-9,12-13,27-28H,10-11H2,1-5H3.
What are the key properties of 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one?
5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one has a molecular weight of 421.49 g/mol, XLogP of 5.29, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-2-pyridin-3-ylchromen-4-one is sourced from PubChem (CID 57405049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).