C21H21ClFN5O — CID 57405961
3-[[5-chloro-1-(4-fluorobutyl)pyrrolo[2,3-c]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one (PubChem CID 57405961) has the molecular formula C21H21ClFN5O and a molecular weight of 413.88 g/mol. Its IUPAC name is 3-[[5-chloro-1-(4-fluorobutyl)pyrrolo[2,3-c]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[[5-chloro-1-(4-fluorobutyl)pyrrolo[2,3-c]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 57405961 |
| Molecular Formula | C21H21ClFN5O |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 3-[[5-chloro-1-(4-fluorobutyl)pyrrolo[2,3-c]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one |
| SMILES | O=c1n(Cc2cc3cc(Cl)ncc3n2CCCCF)c2cnccc2n1C1CC1 |
| InChI | InChI=1S/C21H21ClFN5O/c22-20-10-14-9-16(26(8-2-1-6-23)18(14)12-25-20)13-27-19-11-24-7-5-17(19)28(21(27)29)15-3-4-15/h5,7,9-12,15H,1-4,6,8,13H2 |
| InChIKey | GCTARBLUNQOZLP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 57.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|