C20H13N7O2 — CID 57406221
6-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]methyl]quinoline (PubChem CID 57406221) has the molecular formula C20H13N7O2 and a molecular weight of 383.37 g/mol. Its IUPAC name is 6-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]methyl]quinoline.
| Compound Name | 6-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]methyl]quinoline |
|---|---|
| PubChem CID | 57406221 |
| Molecular Formula | C20H13N7O2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 6-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]methyl]quinoline |
| SMILES | O=[N+]([O-])c1cccc(-c2cnc3nnc(Cc4ccc5ncccc5c4)n3n2)c1 |
| InChI | InChI=1S/C20H13N7O2/c28-27(29)16-5-1-3-15(11-16)18-12-22-20-24-23-19(26(20)25-18)10-13-6-7-17-14(9-13)4-2-8-21-17/h1-9,11-12H,10H2 |
| InChIKey | BVRLCHQECMUEGV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 112.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|