About 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide
4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide (PubChem CID 57406233) has the molecular formula C27H29NO6
and a molecular weight of 463.53 g/mol. Its IUPAC name is 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide.
Molecular Properties
| Compound Name | 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide |
| PubChem CID | 57406233 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide |
| SMILES | COc1c(-c2ccc(C(N)=O)cc2)oc2c(CC=C(C)C)c(O)c(CC=C(C)C)c(O)c2c1=O |
| InChI | InChI=1S/C27H29NO6/c1-14(2)6-12-18-21(29)19(13-7-15(3)4)25-20(22(18)30)23(31)26(33-5)24(34-25)16-8-10-17(11-9-16)27(28)32/h6-11,29-30H,12-13H2,1-5H3,(H2,28,32) |
| InChIKey | KLFAPQJJBBAKIA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide?
The IUPAC name of 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide (CID 57406233) is 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide.
What is the SMILES notation for 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide?
The canonical SMILES for 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide is COc1c(-c2ccc(C(N)=O)cc2)oc2c(CC=C(C)C)c(O)c(CC=C(C)C)c(O)c2c1=O.
What is the InChIKey of 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide?
The InChIKey is KLFAPQJJBBAKIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29NO6/c1-14(2)6-12-18-21(29)19(13-7-15(3)4)25-20(22(18)30)23(31)26(33-5)24(34-25)16-8-10-17(11-9-16)27(28)32/h6-11,29-30H,12-13H2,1-5H3,(H2,28,32).
What are the key properties of 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide?
4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide has a molecular weight of 463.53 g/mol, XLogP of 5.00, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]benzamide is sourced from PubChem (CID 57406233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).