C25H30ClN5O2 — CID 57406331
1-N-[(4-chlorophenyl)methyl]-4-N-[[4-(diethylamino)phenyl]methyl]-3,5-dimethylpyrazole-1,4-dicarboxamide (PubChem CID 57406331) has the molecular formula C25H30ClN5O2 and a molecular weight of 468.00 g/mol. Its IUPAC name is 1-N-[(4-chlorophenyl)methyl]-4-N-[[4-(diethylamino)phenyl]methyl]-3,5-dimethylpyrazole-1,4-dicarboxamide.
| Compound Name | 1-N-[(4-chlorophenyl)methyl]-4-N-[[4-(diethylamino)phenyl]methyl]-3,5-dimethylpyrazole-1,4-dicarboxamide |
|---|---|
| PubChem CID | 57406331 |
| Molecular Formula | C25H30ClN5O2 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 1-N-[(4-chlorophenyl)methyl]-4-N-[[4-(diethylamino)phenyl]methyl]-3,5-dimethylpyrazole-1,4-dicarboxamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)c2c(C)nn(C(=O)NCc3ccc(Cl)cc3)c2C)cc1 |
| InChI | InChI=1S/C25H30ClN5O2/c1-5-30(6-2)22-13-9-20(10-14-22)15-27-24(32)23-17(3)29-31(18(23)4)25(33)28-16-19-7-11-21(26)12-8-19/h7-14H,5-6,15-16H2,1-4H3,(H,27,32)(H,28,33) |
| InChIKey | KUGHPHFVDWCPGE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|