C24H33N7O6S — CID 57406420
1-[3-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]propyl]-3-(4-tert-butylphenyl)urea (PubChem CID 57406420) has the molecular formula C24H33N7O6S and a molecular weight of 547.64 g/mol. Its IUPAC name is 1-[3-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]propyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]propyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 57406420 |
| Molecular Formula | C24H33N7O6S |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 1-[3-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]propyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)NCCCS(=O)(=O)C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C24H33N7O6S/c1-24(2,3)14-5-7-15(8-6-14)30-23(34)26-9-4-10-38(35,36)11-16-18(32)19(33)22(37-16)31-13-29-17-20(25)27-12-28-21(17)31/h5-8,12-13,16,18-19,22,32-33H,4,9-11H2,1-3H3,(H2,25,27,28)(H2,26,30,34)/t16-,18-,19-,22-/m1/s1 |
| InChIKey | CVIMGLRSHGCZEK-WGQQHEPDSA-N |
| XLogP | 0.95 |
| TPSA | 194.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|