C28H31N7O — CID 57406992
2-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-5-(naphthalen-1-ylmethyl)-8,9-dihydro-7H-pyrimido[2,1-b]purin-4-one (PubChem CID 57406992) has the molecular formula C28H31N7O and a molecular weight of 481.60 g/mol. Its IUPAC name is 2-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-5-(naphthalen-1-ylmethyl)-8,9-dihydro-7H-pyrimido[2,1-b]purin-4-one.
| Compound Name | 2-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-5-(naphthalen-1-ylmethyl)-8,9-dihydro-7H-pyrimido[2,1-b]purin-4-one |
|---|---|
| PubChem CID | 57406992 |
| Molecular Formula | C28H31N7O |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 2-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-5-(naphthalen-1-ylmethyl)-8,9-dihydro-7H-pyrimido[2,1-b]purin-4-one |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)nc2c1C(=O)N(Cc1cccc3ccccc13)C1=NCCCN12 |
| InChI | InChI=1S/C28H31N7O/c1-2-3-16-33-24-25(31-28(33)32-15-7-12-22(29)19-32)34-17-8-14-30-27(34)35(26(24)36)18-21-11-6-10-20-9-4-5-13-23(20)21/h4-6,9-11,13,22H,7-8,12,14-19,29H2,1H3/t22-/m1/s1 |
| InChIKey | RIMHBNSDKFHPQR-JOCHJYFZSA-N |
| XLogP | 3.21 |
| TPSA | 82.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|